C38H34Cl2FN3O3 — CID 86672587
SCHEMBL13275718 (PubChem CID 86672587) has the molecular formula C38H34Cl2FN3O3 and a molecular weight of 670.61 g/mol.
| Compound Name | SCHEMBL13275718 |
|---|---|
| PubChem CID | 86672587 |
| Molecular Formula | C38H34Cl2FN3O3 |
| Molecular Weight | 670.61 g/mol |
| Exact Mass | 669.20 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC2(CC1)N1[C@H](c3ccccc3)[C@H](c3ccccc3)OC(=O)[C@H]1[C@H](c1ccnc(Cl)c1F)[C@@]21C(=O)Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C38H34Cl2FN3O3/c1-36(2)16-18-37(19-17-36)38(26-14-13-24(39)21-27(26)43-35(38)46)28(25-15-20-42-33(40)29(25)41)31-34(45)47-32(23-11-7-4-8-12-23)30(44(31)37)22-9-5-3-6-10-22/h3-15,20-21,28,30-32H,16-19H2,1-2H3,(H,43,46)/t28-,30+,31+,32-,38-/m0/s1 |
| InChIKey | PCZXMOMYVGXGIN-RFOHGIDVSA-N |
| XLogP | 8.56 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.61 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|