C20H19F3N2O4 — CID 86674283
ethyl 3-[[5-[2-formyl-3-methyl-5-(trifluoromethyl)phenyl]pyridine-2-carbonyl]amino]propanoate (PubChem CID 86674283) has the molecular formula C20H19F3N2O4 and a molecular weight of 408.38 g/mol. Its IUPAC name is ethyl 3-[[5-[2-formyl-3-methyl-5-(trifluoromethyl)phenyl]pyridine-2-carbonyl]amino]propanoate.
| Compound Name | ethyl 3-[[5-[2-formyl-3-methyl-5-(trifluoromethyl)phenyl]pyridine-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 86674283 |
| Molecular Formula | C20H19F3N2O4 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | ethyl 3-[[5-[2-formyl-3-methyl-5-(trifluoromethyl)phenyl]pyridine-2-carbonyl]amino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)c1ccc(-c2cc(C(F)(F)F)cc(C)c2C=O)cn1 |
| InChI | InChI=1S/C20H19F3N2O4/c1-3-29-18(27)6-7-24-19(28)17-5-4-13(10-25-17)15-9-14(20(21,22)23)8-12(2)16(15)11-26/h4-5,8-11H,3,6-7H2,1-2H3,(H,24,28) |
| InChIKey | RDSVEPUEDPWBJQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|