C18H17ClN2O4 — CID 86674245
ethyl 3-[[5-(4-chloro-2-formylphenyl)pyridine-2-carbonyl]amino]propanoate (PubChem CID 86674245) has the molecular formula C18H17ClN2O4 and a molecular weight of 360.80 g/mol. Its IUPAC name is ethyl 3-[[5-(4-chloro-2-formylphenyl)pyridine-2-carbonyl]amino]propanoate.
| Compound Name | ethyl 3-[[5-(4-chloro-2-formylphenyl)pyridine-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 86674245 |
| Molecular Formula | C18H17ClN2O4 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | ethyl 3-[[5-(4-chloro-2-formylphenyl)pyridine-2-carbonyl]amino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)c1ccc(-c2ccc(Cl)cc2C=O)cn1 |
| InChI | InChI=1S/C18H17ClN2O4/c1-2-25-17(23)7-8-20-18(24)16-6-3-12(10-21-16)15-5-4-14(19)9-13(15)11-22/h3-6,9-11H,2,7-8H2,1H3,(H,20,24) |
| InChIKey | HCFHXSWPNCXAEJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|