C20H22N2O4 — CID 86674244
tert-butyl 3-[[5-(2-formylphenyl)pyridine-2-carbonyl]amino]propanoate (PubChem CID 86674244) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is tert-butyl 3-[[5-(2-formylphenyl)pyridine-2-carbonyl]amino]propanoate.
| Compound Name | tert-butyl 3-[[5-(2-formylphenyl)pyridine-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 86674244 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | tert-butyl 3-[[5-(2-formylphenyl)pyridine-2-carbonyl]amino]propanoate |
| SMILES | CC(C)(C)OC(=O)CCNC(=O)c1ccc(-c2ccccc2C=O)cn1 |
| InChI | InChI=1S/C20H22N2O4/c1-20(2,3)26-18(24)10-11-21-19(25)17-9-8-14(12-22-17)16-7-5-4-6-15(16)13-23/h4-9,12-13H,10-11H2,1-3H3,(H,21,25) |
| InChIKey | ROYYKELREDBRJE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|