C20H24N4O4 — CID 69058505
tert-butyl 3-[[6-[amino(phenyl)carbamoyl]pyridine-3-carbonyl]amino]propanoate (PubChem CID 69058505) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is tert-butyl 3-[[6-[amino(phenyl)carbamoyl]pyridine-3-carbonyl]amino]propanoate.
| Compound Name | tert-butyl 3-[[6-[amino(phenyl)carbamoyl]pyridine-3-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 69058505 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | tert-butyl 3-[[6-[amino(phenyl)carbamoyl]pyridine-3-carbonyl]amino]propanoate |
| SMILES | CC(C)(C)OC(=O)CCNC(=O)c1ccc(C(=O)N(N)c2ccccc2)nc1 |
| InChI | InChI=1S/C20H24N4O4/c1-20(2,3)28-17(25)11-12-22-18(26)14-9-10-16(23-13-14)19(27)24(21)15-7-5-4-6-8-15/h4-10,13H,11-12,21H2,1-3H3,(H,22,26) |
| InChIKey | XTXQKTCKXWPMET-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|