C15H19N3O5S — CID 171804919
tert-butyl 3-[(5-cyano-6-methylsulfonylpyridine-2-carbonyl)amino]propanoate (PubChem CID 171804919) has the molecular formula C15H19N3O5S and a molecular weight of 353.40 g/mol. Its IUPAC name is tert-butyl 3-[(5-cyano-6-methylsulfonylpyridine-2-carbonyl)amino]propanoate.
| Compound Name | tert-butyl 3-[(5-cyano-6-methylsulfonylpyridine-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 171804919 |
| Molecular Formula | C15H19N3O5S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | tert-butyl 3-[(5-cyano-6-methylsulfonylpyridine-2-carbonyl)amino]propanoate |
| SMILES | CC(C)(C)OC(=O)CCNC(=O)c1ccc(C#N)c(S(C)(=O)=O)n1 |
| InChI | InChI=1S/C15H19N3O5S/c1-15(2,3)23-12(19)7-8-17-13(20)11-6-5-10(9-16)14(18-11)24(4,21)22/h5-6H,7-8H2,1-4H3,(H,17,20) |
| InChIKey | BSSPBRHATPGIHK-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 126.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |