C12H20O4 — CID 86678537
2-[(1S,3S,4R)-3-ethoxycarbonyl-4-ethylcyclopentyl]acetic acid (PubChem CID 86678537) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-[(1S,3S,4R)-3-ethoxycarbonyl-4-ethylcyclopentyl]acetic acid.
| Compound Name | 2-[(1S,3S,4R)-3-ethoxycarbonyl-4-ethylcyclopentyl]acetic acid |
|---|---|
| PubChem CID | 86678537 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 2-[(1S,3S,4R)-3-ethoxycarbonyl-4-ethylcyclopentyl]acetic acid |
| SMILES | CCOC(=O)[C@H]1C[C@@H](CC(=O)O)C[C@H]1CC |
| InChI | InChI=1S/C12H20O4/c1-3-9-5-8(7-11(13)14)6-10(9)12(15)16-4-2/h8-10H,3-7H2,1-2H3,(H,13,14)/t8-,9+,10-/m0/s1 |
| InChIKey | LTEGXWZMDBXXLU-AEJSXWLSSA-N |
| XLogP | 2.08 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |