C24H32F3N5O6S — CID 86679947
tert-butyl N-[[4-[[2-butoxy-6-(trifluoromethyl)-3-pyridinyl]methylcarbamoylamino]phenyl]methylsulfamoyl]carbamate (PubChem CID 86679947) has the molecular formula C24H32F3N5O6S and a molecular weight of 575.61 g/mol. Its IUPAC name is tert-butyl N-[[4-[[2-butoxy-6-(trifluoromethyl)-3-pyridinyl]methylcarbamoylamino]phenyl]methylsulfamoyl]carbamate.
| Compound Name | tert-butyl N-[[4-[[2-butoxy-6-(trifluoromethyl)-3-pyridinyl]methylcarbamoylamino]phenyl]methylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 86679947 |
| Molecular Formula | C24H32F3N5O6S |
| Molecular Weight | 575.61 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | tert-butyl N-[[4-[[2-butoxy-6-(trifluoromethyl)-3-pyridinyl]methylcarbamoylamino]phenyl]methylsulfamoyl]carbamate |
| SMILES | CCCCOc1nc(C(F)(F)F)ccc1CNC(=O)Nc1ccc(CNS(=O)(=O)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H32F3N5O6S/c1-5-6-13-37-20-17(9-12-19(31-20)24(25,26)27)15-28-21(33)30-18-10-7-16(8-11-18)14-29-39(35,36)32-22(34)38-23(2,3)4/h7-12,29H,5-6,13-15H2,1-4H3,(H,32,34)(H2,28,30,33) |
| InChIKey | LSGXFEUVMRGIRC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 147.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.61 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|