C14H18ClFN2O — CID 86680468
(8aS)-7-[(3-fluorophenyl)methyl]-2,3,4,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-6-one;hydrochloride (PubChem CID 86680468) has the molecular formula C14H18ClFN2O and a molecular weight of 284.76 g/mol. Its IUPAC name is (8aS)-7-[(3-fluorophenyl)methyl]-2,3,4,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-6-one;hydrochloride.
| Compound Name | (8aS)-7-[(3-fluorophenyl)methyl]-2,3,4,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-6-one;hydrochloride |
|---|---|
| PubChem CID | 86680468 |
| Molecular Formula | C14H18ClFN2O |
| Molecular Weight | 284.76 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | (8aS)-7-[(3-fluorophenyl)methyl]-2,3,4,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-6-one;hydrochloride |
| SMILES | Cl.O=C1C(Cc2cccc(F)c2)C[C@H]2CNCCN12 |
| InChI | InChI=1S/C14H17FN2O.ClH/c15-12-3-1-2-10(7-12)6-11-8-13-9-16-4-5-17(13)14(11)18;/h1-3,7,11,13,16H,4-6,8-9H2;1H/t11?,13-;/m0./s1 |
| InChIKey | FSZSXEHXDMLUFM-IYWIJXFJSA-N |
| XLogP | 1.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.76 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |