C18H17N3O3S2 — CID 8668070
[2-oxo-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]ethyl] 4-ethylthiadiazole-5-carboxylate (PubChem CID 8668070) has the molecular formula C18H17N3O3S2 and a molecular weight of 387.49 g/mol. Its IUPAC name is [2-oxo-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]ethyl] 4-ethylthiadiazole-5-carboxylate.
| Compound Name | [2-oxo-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]ethyl] 4-ethylthiadiazole-5-carboxylate |
|---|---|
| PubChem CID | 8668070 |
| Molecular Formula | C18H17N3O3S2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | [2-oxo-2-[[(S)-phenyl(thiophen-2-yl)methyl]amino]ethyl] 4-ethylthiadiazole-5-carboxylate |
| SMILES | CCc1nnsc1C(=O)OCC(=O)N[C@@H](c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C18H17N3O3S2/c1-2-13-17(26-21-20-13)18(23)24-11-15(22)19-16(14-9-6-10-25-14)12-7-4-3-5-8-12/h3-10,16H,2,11H2,1H3,(H,19,22)/t16-/m0/s1 |
| InChIKey | QLMRFMVAHIDTIQ-INIZCTEOSA-N |
| XLogP | 3.22 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |