C22H17F6NO4 — CID 86682258
(4S)-3-[(2S)-2-[(S)-[3,5-bis(trifluoromethyl)phenyl]-hydroxymethyl]but-3-enoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 86682258) has the molecular formula C22H17F6NO4 and a molecular weight of 473.37 g/mol. Its IUPAC name is (4S)-3-[(2S)-2-[(S)-[3,5-bis(trifluoromethyl)phenyl]-hydroxymethyl]but-3-enoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2S)-2-[(S)-[3,5-bis(trifluoromethyl)phenyl]-hydroxymethyl]but-3-enoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 86682258 |
| Molecular Formula | C22H17F6NO4 |
| Molecular Weight | 473.37 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | (4S)-3-[(2S)-2-[(S)-[3,5-bis(trifluoromethyl)phenyl]-hydroxymethyl]but-3-enoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@H](C(=O)N1C(=O)OC[C@@H]1c1ccccc1)[C@H](O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H17F6NO4/c1-2-16(19(31)29-17(11-33-20(29)32)12-6-4-3-5-7-12)18(30)13-8-14(21(23,24)25)10-15(9-13)22(26,27)28/h2-10,16-18,30H,1,11H2/t16-,17+,18+/m0/s1 |
| InChIKey | YMEYVSDFQUIEQT-RCCFBDPRSA-N |
| XLogP | 5.28 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.37 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|