C16H18F4N8O — CID 86683348
5-[[5-tert-butyl-7-(3,3,4,4-tetrafluoropyrrolidin-1-yl)triazolo[4,5-d]pyrimidin-3-yl]methyl]-3-methyl-1,2,4-oxadiazole (PubChem CID 86683348) has the molecular formula C16H18F4N8O and a molecular weight of 414.37 g/mol. Its IUPAC name is 5-[[5-tert-butyl-7-(3,3,4,4-tetrafluoropyrrolidin-1-yl)triazolo[4,5-d]pyrimidin-3-yl]methyl]-3-methyl-1,2,4-oxadiazole.
| Compound Name | 5-[[5-tert-butyl-7-(3,3,4,4-tetrafluoropyrrolidin-1-yl)triazolo[4,5-d]pyrimidin-3-yl]methyl]-3-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 86683348 |
| Molecular Formula | C16H18F4N8O |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 5-[[5-tert-butyl-7-(3,3,4,4-tetrafluoropyrrolidin-1-yl)triazolo[4,5-d]pyrimidin-3-yl]methyl]-3-methyl-1,2,4-oxadiazole |
| SMILES | Cc1noc(Cn2nnc3c(N4CC(F)(F)C(F)(F)C4)nc(C(C)(C)C)nc32)n1 |
| InChI | InChI=1S/C16H18F4N8O/c1-8-21-9(29-25-8)5-28-12-10(24-26-28)11(22-13(23-12)14(2,3)4)27-6-15(17,18)16(19,20)7-27/h5-7H2,1-4H3 |
| InChIKey | MWTYICDDAUBQQP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 98.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|