C19H21BFN3O5 — CID 86684434
[3-(acetyloxymethyl)-2-(10-fluoro-1-oxo-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-2-yl)-4-pyridinyl]boronic acid (PubChem CID 86684434) has the molecular formula C19H21BFN3O5 and a molecular weight of 401.20 g/mol. Its IUPAC name is [3-(acetyloxymethyl)-2-(10-fluoro-1-oxo-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-2-yl)-4-pyridinyl]boronic acid.
| Compound Name | [3-(acetyloxymethyl)-2-(10-fluoro-1-oxo-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-2-yl)-4-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 86684434 |
| Molecular Formula | C19H21BFN3O5 |
| Molecular Weight | 401.20 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | [3-(acetyloxymethyl)-2-(10-fluoro-1-oxo-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-2-yl)-4-pyridinyl]boronic acid |
| SMILES | CC(=O)OCc1c(B(O)O)ccnc1N1CCn2c3c(c(F)c2C1=O)CCCC3 |
| InChI | InChI=1S/C19H21BFN3O5/c1-11(25)29-10-13-14(20(27)28)6-7-22-18(13)24-9-8-23-15-5-3-2-4-12(15)16(21)17(23)19(24)26/h6-7,27-28H,2-5,8-10H2,1H3 |
| InChIKey | BZIAICPPXJVWKF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.20 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|