C19H22N4O5 — CID 90277420
[4-(dihydroxyamino)-2-(1-oxo-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-2-yl)-3-pyridinyl]methyl acetate (PubChem CID 90277420) has the molecular formula C19H22N4O5 and a molecular weight of 386.41 g/mol. Its IUPAC name is [4-(dihydroxyamino)-2-(1-oxo-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-2-yl)-3-pyridinyl]methyl acetate.
| Compound Name | [4-(dihydroxyamino)-2-(1-oxo-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-2-yl)-3-pyridinyl]methyl acetate |
|---|---|
| PubChem CID | 90277420 |
| Molecular Formula | C19H22N4O5 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | [4-(dihydroxyamino)-2-(1-oxo-3,4,6,7,8,9-hexahydropyrazino[1,2-a]indol-2-yl)-3-pyridinyl]methyl acetate |
| SMILES | CC(=O)OCc1c(N(O)O)ccnc1N1CCn2c(cc3c2CCCC3)C1=O |
| InChI | InChI=1S/C19H22N4O5/c1-12(24)28-11-14-16(23(26)27)6-7-20-18(14)22-9-8-21-15-5-3-2-4-13(15)10-17(21)19(22)25/h6-7,10,26-27H,2-5,8-9,11H2,1H3 |
| InChIKey | HWLYYPPQPGFMPW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|