C14H19NO5 — CID 86684677
ethyl 3-(2,6-dimethoxy-3-pyridinyl)-3-ethoxyprop-2-enoate (PubChem CID 86684677) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is ethyl 3-(2,6-dimethoxy-3-pyridinyl)-3-ethoxyprop-2-enoate.
| Compound Name | ethyl 3-(2,6-dimethoxy-3-pyridinyl)-3-ethoxyprop-2-enoate |
|---|---|
| PubChem CID | 86684677 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | ethyl 3-(2,6-dimethoxy-3-pyridinyl)-3-ethoxyprop-2-enoate |
| SMILES | CCOC(=O)C=C(OCC)c1ccc(OC)nc1OC |
| InChI | InChI=1S/C14H19NO5/c1-5-19-11(9-13(16)20-6-2)10-7-8-12(17-3)15-14(10)18-4/h7-9H,5-6H2,1-4H3 |
| InChIKey | WOOSAQXWZHQYOX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|