C16H21N3O6 — CID 3867735
ethyl 3-[2-(2,6-dimethoxypyridine-3-carbonyl)pyrazolidin-1-yl]-3-oxopropanoate (PubChem CID 3867735) has the molecular formula C16H21N3O6 and a molecular weight of 351.36 g/mol. Its IUPAC name is ethyl 3-[2-(2,6-dimethoxypyridine-3-carbonyl)pyrazolidin-1-yl]-3-oxopropanoate.
| Compound Name | ethyl 3-[2-(2,6-dimethoxypyridine-3-carbonyl)pyrazolidin-1-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 3867735 |
| Molecular Formula | C16H21N3O6 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | ethyl 3-[2-(2,6-dimethoxypyridine-3-carbonyl)pyrazolidin-1-yl]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)N1CCCN1C(=O)c1ccc(OC)nc1OC |
| InChI | InChI=1S/C16H21N3O6/c1-4-25-14(21)10-13(20)18-8-5-9-19(18)16(22)11-6-7-12(23-2)17-15(11)24-3/h6-7H,4-5,8-10H2,1-3H3 |
| InChIKey | NPMUIOFLTKDTHZ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 98.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|