C14H20N4O3S — CID 3850000
2-(2,6-dimethoxypyridine-3-carbonyl)-N-ethylpyrazolidine-1-carbothioamide (PubChem CID 3850000) has the molecular formula C14H20N4O3S and a molecular weight of 324.41 g/mol. Its IUPAC name is 2-(2,6-dimethoxypyridine-3-carbonyl)-N-ethylpyrazolidine-1-carbothioamide.
| Compound Name | 2-(2,6-dimethoxypyridine-3-carbonyl)-N-ethylpyrazolidine-1-carbothioamide |
|---|---|
| PubChem CID | 3850000 |
| Molecular Formula | C14H20N4O3S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-(2,6-dimethoxypyridine-3-carbonyl)-N-ethylpyrazolidine-1-carbothioamide |
| SMILES | CCNC(=S)N1CCCN1C(=O)c1ccc(OC)nc1OC |
| InChI | InChI=1S/C14H20N4O3S/c1-4-15-14(22)18-9-5-8-17(18)13(19)10-6-7-11(20-2)16-12(10)21-3/h6-7H,4-5,8-9H2,1-3H3,(H,15,22) |
| InChIKey | JHZRCJLIVLIBCO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|