C14H20N2O5 — CID 86684678
ethyl (Z)-3-(2,6-dimethoxy-3-pyridinyl)-3-(2-hydroxyethylamino)prop-2-enoate (PubChem CID 86684678) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is ethyl (Z)-3-(2,6-dimethoxy-3-pyridinyl)-3-(2-hydroxyethylamino)prop-2-enoate.
| Compound Name | ethyl (Z)-3-(2,6-dimethoxy-3-pyridinyl)-3-(2-hydroxyethylamino)prop-2-enoate |
|---|---|
| PubChem CID | 86684678 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | ethyl (Z)-3-(2,6-dimethoxy-3-pyridinyl)-3-(2-hydroxyethylamino)prop-2-enoate |
| SMILES | CCOC(=O)/C=C(\NCCO)c1ccc(OC)nc1OC |
| InChI | InChI=1S/C14H20N2O5/c1-4-21-13(18)9-11(15-7-8-17)10-5-6-12(19-2)16-14(10)20-3/h5-6,9,15,17H,4,7-8H2,1-3H3/b11-9- |
| InChIKey | OGWJPYDQJSAUAR-LUAWRHEFSA-N |
| XLogP | 0.58 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|