C12H11F4NO2 — CID 86686697
2,2,2-trifluoro-N-[(1S,4R)-7-fluoro-4-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide (PubChem CID 86686697) has the molecular formula C12H11F4NO2 and a molecular weight of 277.22 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(1S,4R)-7-fluoro-4-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(1S,4R)-7-fluoro-4-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 86686697 |
| Molecular Formula | C12H11F4NO2 |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2,2,2-trifluoro-N-[(1S,4R)-7-fluoro-4-hydroxy-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
| SMILES | O=C(N[C@H]1CC[C@@H](O)c2ccc(F)cc21)C(F)(F)F |
| InChI | InChI=1S/C12H11F4NO2/c13-6-1-2-7-8(5-6)9(3-4-10(7)18)17-11(19)12(14,15)16/h1-2,5,9-10,18H,3-4H2,(H,17,19)/t9-,10+/m0/s1 |
| InChIKey | IAVJGJFUPVFGMZ-VHSXEESVSA-N |
| XLogP | 2.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |