C23H25N7O4S2 — CID 86689639
tert-butyl N-[(3R,4R)-4-[[7-([1,3]thiazolo[4,5-b]pyridin-2-ylcarbamoyl)thieno[3,2-d]pyrimidin-2-yl]amino]oxan-3-yl]carbamate (PubChem CID 86689639) has the molecular formula C23H25N7O4S2 and a molecular weight of 527.63 g/mol. Its IUPAC name is tert-butyl N-[(3R,4R)-4-[[7-([1,3]thiazolo[4,5-b]pyridin-2-ylcarbamoyl)thieno[3,2-d]pyrimidin-2-yl]amino]oxan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4R)-4-[[7-([1,3]thiazolo[4,5-b]pyridin-2-ylcarbamoyl)thieno[3,2-d]pyrimidin-2-yl]amino]oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 86689639 |
| Molecular Formula | C23H25N7O4S2 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | tert-butyl N-[(3R,4R)-4-[[7-([1,3]thiazolo[4,5-b]pyridin-2-ylcarbamoyl)thieno[3,2-d]pyrimidin-2-yl]amino]oxan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1COCC[C@H]1Nc1ncc2scc(C(=O)Nc3nc4ncccc4s3)c2n1 |
| InChI | InChI=1S/C23H25N7O4S2/c1-23(2,3)34-22(32)27-14-10-33-8-6-13(14)26-20-25-9-16-17(28-20)12(11-35-16)19(31)30-21-29-18-15(36-21)5-4-7-24-18/h4-5,7,9,11,13-14H,6,8,10H2,1-3H3,(H,27,32)(H,25,26,28)(H,24,29,30,31)/t13-,14+/m1/s1 |
| InChIKey | YSWFULTVMPOJRB-KGLIPLIRSA-N |
| XLogP | 4.04 |
| TPSA | 140.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |