C14H17ClFNO3 — CID 86692264
ethyl 6-chloro-2-fluoro-3-[(2-methylpropanoylamino)methyl]benzoate (PubChem CID 86692264) has the molecular formula C14H17ClFNO3 and a molecular weight of 301.75 g/mol. Its IUPAC name is ethyl 6-chloro-2-fluoro-3-[(2-methylpropanoylamino)methyl]benzoate.
| Compound Name | ethyl 6-chloro-2-fluoro-3-[(2-methylpropanoylamino)methyl]benzoate |
|---|---|
| PubChem CID | 86692264 |
| Molecular Formula | C14H17ClFNO3 |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | ethyl 6-chloro-2-fluoro-3-[(2-methylpropanoylamino)methyl]benzoate |
| SMILES | CCOC(=O)c1c(Cl)ccc(CNC(=O)C(C)C)c1F |
| InChI | InChI=1S/C14H17ClFNO3/c1-4-20-14(19)11-10(15)6-5-9(12(11)16)7-17-13(18)8(2)3/h5-6,8H,4,7H2,1-3H3,(H,17,18) |
| InChIKey | IVSUMZFBQMQNKB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |