C18H18N6O3 — CID 86694195
1H-benzimidazol-2-yl-[4-[(3-nitro-2-pyridinyl)amino]piperidin-1-yl]methanone (PubChem CID 86694195) has the molecular formula C18H18N6O3 and a molecular weight of 366.38 g/mol. Its IUPAC name is 1H-benzimidazol-2-yl-[4-[(3-nitro-2-pyridinyl)amino]piperidin-1-yl]methanone.
| Compound Name | 1H-benzimidazol-2-yl-[4-[(3-nitro-2-pyridinyl)amino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 86694195 |
| Molecular Formula | C18H18N6O3 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 1H-benzimidazol-2-yl-[4-[(3-nitro-2-pyridinyl)amino]piperidin-1-yl]methanone |
| SMILES | O=C(c1nc2ccccc2[nH]1)N1CCC(Nc2ncccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C18H18N6O3/c25-18(17-21-13-4-1-2-5-14(13)22-17)23-10-7-12(8-11-23)20-16-15(24(26)27)6-3-9-19-16/h1-6,9,12H,7-8,10-11H2,(H,19,20)(H,21,22) |
| InChIKey | YFVRJNGLZBPCAU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 117.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|