C18H26N2O7SSi — CID 86694358
(3aR,6R,6aR)-6-[tert-butyl(dimethyl)silyl]oxy-3-(2-nitrophenyl)sulfonyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxazol-2-one (PubChem CID 86694358) has the molecular formula C18H26N2O7SSi and a molecular weight of 442.57 g/mol. Its IUPAC name is (3aR,6R,6aR)-6-[tert-butyl(dimethyl)silyl]oxy-3-(2-nitrophenyl)sulfonyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxazol-2-one.
| Compound Name | (3aR,6R,6aR)-6-[tert-butyl(dimethyl)silyl]oxy-3-(2-nitrophenyl)sulfonyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 86694358 |
| Molecular Formula | C18H26N2O7SSi |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | (3aR,6R,6aR)-6-[tert-butyl(dimethyl)silyl]oxy-3-(2-nitrophenyl)sulfonyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]oxazol-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC[C@@H]2[C@H]1OC(=O)N2S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H26N2O7SSi/c1-18(2,3)29(4,5)27-14-11-10-13-16(14)26-17(21)19(13)28(24,25)15-9-7-6-8-12(15)20(22)23/h6-9,13-14,16H,10-11H2,1-5H3/t13-,14-,16-/m1/s1 |
| InChIKey | UZWGAKKBEAQEMR-IIAWOOMASA-N |
| XLogP | 3.66 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|