C26H31N3O3 — CID 86694409
tert-butyl N-[1-[[5-cyclopentyl-6-(2-phenylethynyl)-2-pyridinyl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 86694409) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is tert-butyl N-[1-[[5-cyclopentyl-6-(2-phenylethynyl)-2-pyridinyl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[5-cyclopentyl-6-(2-phenylethynyl)-2-pyridinyl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 86694409 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | tert-butyl N-[1-[[5-cyclopentyl-6-(2-phenylethynyl)-2-pyridinyl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)Nc1ccc(C2CCCC2)c(C#Cc2ccccc2)n1 |
| InChI | InChI=1S/C26H31N3O3/c1-18(27-25(31)32-26(2,3)4)24(30)29-23-17-15-21(20-12-8-9-13-20)22(28-23)16-14-19-10-6-5-7-11-19/h5-7,10-11,15,17-18,20H,8-9,12-13H2,1-4H3,(H,27,31)(H,28,29,30) |
| InChIKey | LRBNMJDEJBWDGA-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|