C20H27N5O5S — CID 86696328
acetic acid;1-[5-[6-[3-(methylamino)propylamino]imidazo[1,2-b]pyridazin-3-yl]thiophen-2-yl]ethanone (PubChem CID 86696328) has the molecular formula C20H27N5O5S and a molecular weight of 449.53 g/mol. Its IUPAC name is acetic acid;1-[5-[6-[3-(methylamino)propylamino]imidazo[1,2-b]pyridazin-3-yl]thiophen-2-yl]ethanone.
| Compound Name | acetic acid;1-[5-[6-[3-(methylamino)propylamino]imidazo[1,2-b]pyridazin-3-yl]thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 86696328 |
| Molecular Formula | C20H27N5O5S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | acetic acid;1-[5-[6-[3-(methylamino)propylamino]imidazo[1,2-b]pyridazin-3-yl]thiophen-2-yl]ethanone |
| SMILES | CC(=O)O.CC(=O)O.CNCCCNc1ccc2ncc(-c3ccc(C(C)=O)s3)n2n1 |
| InChI | InChI=1S/C16H19N5OS.2C2H4O2/c1-11(22)13-4-5-14(23-13)12-10-19-16-7-6-15(20-21(12)16)18-9-3-8-17-2;2*1-2(3)4/h4-7,10,17H,3,8-9H2,1-2H3,(H,18,20);2*1H3,(H,3,4) |
| InChIKey | XGGLQLTWXAFQFK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 145.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|