C19H20N6O — CID 25103807
3-[[3-(1-benzylpyrazol-4-yl)imidazo[1,2-b]pyridazin-6-yl]amino]propan-1-ol (PubChem CID 25103807) has the molecular formula C19H20N6O and a molecular weight of 348.41 g/mol. Its IUPAC name is 3-[[3-(1-benzylpyrazol-4-yl)imidazo[1,2-b]pyridazin-6-yl]amino]propan-1-ol.
| Compound Name | 3-[[3-(1-benzylpyrazol-4-yl)imidazo[1,2-b]pyridazin-6-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 25103807 |
| Molecular Formula | C19H20N6O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 3-[[3-(1-benzylpyrazol-4-yl)imidazo[1,2-b]pyridazin-6-yl]amino]propan-1-ol |
| SMILES | OCCCNc1ccc2ncc(-c3cnn(Cc4ccccc4)c3)n2n1 |
| InChI | InChI=1S/C19H20N6O/c26-10-4-9-20-18-7-8-19-21-12-17(25(19)23-18)16-11-22-24(14-16)13-15-5-2-1-3-6-15/h1-3,5-8,11-12,14,26H,4,9-10,13H2,(H,20,23) |
| InChIKey | RXPXYZYROMKRFK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|