C16H18N4O2 — CID 126470569
3-[[3-(2-methoxyphenyl)imidazo[1,2-b]pyridazin-6-yl]amino]propan-1-ol (PubChem CID 126470569) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 3-[[3-(2-methoxyphenyl)imidazo[1,2-b]pyridazin-6-yl]amino]propan-1-ol.
| Compound Name | 3-[[3-(2-methoxyphenyl)imidazo[1,2-b]pyridazin-6-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 126470569 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 3-[[3-(2-methoxyphenyl)imidazo[1,2-b]pyridazin-6-yl]amino]propan-1-ol |
| SMILES | COc1ccccc1-c1cnc2ccc(NCCCO)nn12 |
| InChI | InChI=1S/C16H18N4O2/c1-22-14-6-3-2-5-12(14)13-11-18-16-8-7-15(19-20(13)16)17-9-4-10-21/h2-3,5-8,11,21H,4,9-10H2,1H3,(H,17,19) |
| InChIKey | SVUAKAROEAYJRL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|