C11H12N4O — CID 144888691
3-[(3-ethynylimidazo[1,2-b]pyridazin-6-yl)amino]propan-1-ol (PubChem CID 144888691) has the molecular formula C11H12N4O and a molecular weight of 216.24 g/mol. Its IUPAC name is 3-[(3-ethynylimidazo[1,2-b]pyridazin-6-yl)amino]propan-1-ol.
| Compound Name | 3-[(3-ethynylimidazo[1,2-b]pyridazin-6-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 144888691 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 3-[(3-ethynylimidazo[1,2-b]pyridazin-6-yl)amino]propan-1-ol |
| SMILES | C#Cc1cnc2ccc(NCCCO)nn12 |
| InChI | InChI=1S/C11H12N4O/c1-2-9-8-13-11-5-4-10(14-15(9)11)12-6-3-7-16/h1,4-5,8,16H,3,6-7H2,(H,12,14) |
| InChIKey | RUYUCQJGMAFTEC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|