C17H17FN4O — CID 86696346
4-[6-(butylamino)imidazo[1,2-b]pyridazin-3-yl]-3-fluorobenzaldehyde (PubChem CID 86696346) has the molecular formula C17H17FN4O and a molecular weight of 312.35 g/mol. Its IUPAC name is 4-[6-(butylamino)imidazo[1,2-b]pyridazin-3-yl]-3-fluorobenzaldehyde.
| Compound Name | 4-[6-(butylamino)imidazo[1,2-b]pyridazin-3-yl]-3-fluorobenzaldehyde |
|---|---|
| PubChem CID | 86696346 |
| Molecular Formula | C17H17FN4O |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 4-[6-(butylamino)imidazo[1,2-b]pyridazin-3-yl]-3-fluorobenzaldehyde |
| SMILES | CCCCNc1ccc2ncc(-c3ccc(C=O)cc3F)n2n1 |
| InChI | InChI=1S/C17H17FN4O/c1-2-3-8-19-16-6-7-17-20-10-15(22(17)21-16)13-5-4-12(11-23)9-14(13)18/h4-7,9-11H,2-3,8H2,1H3,(H,19,21) |
| InChIKey | KKKIQLDRGXZVAX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|