C22H28N4O — CID 25104179
3-[3-[(E)-hex-1-enyl]phenyl]-N-(3-methoxypropyl)imidazo[1,2-b]pyridazin-6-amine (PubChem CID 25104179) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is 3-[3-[(E)-hex-1-enyl]phenyl]-N-(3-methoxypropyl)imidazo[1,2-b]pyridazin-6-amine.
| Compound Name | 3-[3-[(E)-hex-1-enyl]phenyl]-N-(3-methoxypropyl)imidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 25104179 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 3-[3-[(E)-hex-1-enyl]phenyl]-N-(3-methoxypropyl)imidazo[1,2-b]pyridazin-6-amine |
| SMILES | CCCC/C=C/c1cccc(-c2cnc3ccc(NCCCOC)nn23)c1 |
| InChI | InChI=1S/C22H28N4O/c1-3-4-5-6-9-18-10-7-11-19(16-18)20-17-24-22-13-12-21(25-26(20)22)23-14-8-15-27-2/h6-7,9-13,16-17H,3-5,8,14-15H2,1-2H3,(H,23,25)/b9-6+ |
| InChIKey | BBUCGVBTCXYNGZ-RMKNXTFCSA-N |
| XLogP | 5.05 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|