C20H31N5O2 — CID 86621015
tert-butyl N-[3-[[3-[(E)-hex-1-enyl]imidazo[1,2-b]pyridazin-6-yl]amino]propyl]carbamate (PubChem CID 86621015) has the molecular formula C20H31N5O2 and a molecular weight of 373.50 g/mol. Its IUPAC name is tert-butyl N-[3-[[3-[(E)-hex-1-enyl]imidazo[1,2-b]pyridazin-6-yl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[3-[(E)-hex-1-enyl]imidazo[1,2-b]pyridazin-6-yl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 86621015 |
| Molecular Formula | C20H31N5O2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | tert-butyl N-[3-[[3-[(E)-hex-1-enyl]imidazo[1,2-b]pyridazin-6-yl]amino]propyl]carbamate |
| SMILES | CCCC/C=C/c1cnc2ccc(NCCCNC(=O)OC(C)(C)C)nn12 |
| InChI | InChI=1S/C20H31N5O2/c1-5-6-7-8-10-16-15-23-18-12-11-17(24-25(16)18)21-13-9-14-22-19(26)27-20(2,3)4/h8,10-12,15H,5-7,9,13-14H2,1-4H3,(H,21,24)(H,22,26)/b10-8+ |
| InChIKey | CGZGZHIQFNJVGT-CSKARUKUSA-N |
| XLogP | 4.26 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|