About 3-hex-1-enyl-N-(3-methoxypropyl)imidazo[1,2-b]pyridazin-6-amine;hydrochloride
3-hex-1-enyl-N-(3-methoxypropyl)imidazo[1,2-b]pyridazin-6-amine;hydrochloride (PubChem CID 68647937) has the molecular formula C16H25ClN4O
and a molecular weight of 324.86 g/mol. Its IUPAC name is 3-hex-1-enyl-N-(3-methoxypropyl)imidazo[1,2-b]pyridazin-6-amine;hydrochloride.
Molecular Properties
| Compound Name | 3-hex-1-enyl-N-(3-methoxypropyl)imidazo[1,2-b]pyridazin-6-amine;hydrochloride |
| PubChem CID | 68647937 |
| Molecular Formula | C16H25ClN4O |
| Molecular Weight | 324.86 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 3-hex-1-enyl-N-(3-methoxypropyl)imidazo[1,2-b]pyridazin-6-amine;hydrochloride |
| SMILES | CCCCC=Cc1cnc2ccc(NCCCOC)nn12.Cl |
| InChI | InChI=1S/C16H24N4O.ClH/c1-3-4-5-6-8-14-13-18-16-10-9-15(19-20(14)16)17-11-7-12-21-2;/h6,8-10,13H,3-5,7,11-12H2,1-2H3,(H,17,19);1H |
| InChIKey | OFJQMAXAKSCZPU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.86 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hex-1-enyl-N-(3-methoxypropyl)imidazo[1,2-b]pyridazin-6-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hex-1-enyl-N-(3-methoxypropyl)imidazo[1,2-b]pyridazin-6-amine;hydrochloride?
The IUPAC name of 3-hex-1-enyl-N-(3-methoxypropyl)imidazo[1,2-b]pyridazin-6-amine;hydrochloride (CID 68647937) is 3-hex-1-enyl-N-(3-methoxypropyl)imidazo[1,2-b]pyridazin-6-amine;hydrochloride.
What is the SMILES notation for 3-hex-1-enyl-N-(3-methoxypropyl)imidazo[1,2-b]pyridazin-6-amine;hydrochloride?
The canonical SMILES for 3-hex-1-enyl-N-(3-methoxypropyl)imidazo[1,2-b]pyridazin-6-amine;hydrochloride is CCCCC=Cc1cnc2ccc(NCCCOC)nn12.Cl.
What is the InChIKey of 3-hex-1-enyl-N-(3-methoxypropyl)imidazo[1,2-b]pyridazin-6-amine;hydrochloride?
The InChIKey is OFJQMAXAKSCZPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N4O.ClH/c1-3-4-5-6-8-14-13-18-16-10-9-15(19-20(14)16)17-11-7-12-21-2;/h6,8-10,13H,3-5,7,11-12H2,1-2H3,(H,17,19);1H.
What are the key properties of 3-hex-1-enyl-N-(3-methoxypropyl)imidazo[1,2-b]pyridazin-6-amine;hydrochloride?
3-hex-1-enyl-N-(3-methoxypropyl)imidazo[1,2-b]pyridazin-6-amine;hydrochloride has a molecular weight of 324.86 g/mol, XLogP of 3.80, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hex-1-enyl-N-(3-methoxypropyl)imidazo[1,2-b]pyridazin-6-amine;hydrochloride is sourced from PubChem (CID 68647937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).