C9H13N5O — CID 35270726
N-(3-methoxypropyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 35270726) has the molecular formula C9H13N5O and a molecular weight of 207.24 g/mol. Its IUPAC name is N-(3-methoxypropyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-(3-methoxypropyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 35270726 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | N-(3-methoxypropyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | COCCCNc1ccc2nncn2n1 |
| InChI | InChI=1S/C9H13N5O/c1-15-6-2-5-10-8-3-4-9-12-11-7-14(9)13-8/h3-4,7H,2,5-6H2,1H3,(H,10,13) |
| InChIKey | PTUZSYBSGKITOJ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|