C18H27N5O — CID 68648132
N-(3-morpholin-4-ylpropyl)-3-pent-1-enylimidazo[1,2-b]pyridazin-6-amine (PubChem CID 68648132) has the molecular formula C18H27N5O and a molecular weight of 329.45 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-3-pent-1-enylimidazo[1,2-b]pyridazin-6-amine.
| Compound Name | N-(3-morpholin-4-ylpropyl)-3-pent-1-enylimidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 68648132 |
| Molecular Formula | C18H27N5O |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-3-pent-1-enylimidazo[1,2-b]pyridazin-6-amine |
| SMILES | CCCC=Cc1cnc2ccc(NCCCN3CCOCC3)nn12 |
| InChI | InChI=1S/C18H27N5O/c1-2-3-4-6-16-15-20-18-8-7-17(21-23(16)18)19-9-5-10-22-11-13-24-14-12-22/h4,6-8,15H,2-3,5,9-14H2,1H3,(H,19,21) |
| InChIKey | LDSXDFWNBJPVLM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 54.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|