C16H21NO4 — CID 86701431
ethyl 3-[[4-[(1R)-1-hydroxybutyl]benzoyl]amino]prop-2-enoate (PubChem CID 86701431) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is ethyl 3-[[4-[(1R)-1-hydroxybutyl]benzoyl]amino]prop-2-enoate.
| Compound Name | ethyl 3-[[4-[(1R)-1-hydroxybutyl]benzoyl]amino]prop-2-enoate |
|---|---|
| PubChem CID | 86701431 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | ethyl 3-[[4-[(1R)-1-hydroxybutyl]benzoyl]amino]prop-2-enoate |
| SMILES | CCC[C@@H](O)c1ccc(C(=O)NC=CC(=O)OCC)cc1 |
| InChI | InChI=1S/C16H21NO4/c1-3-5-14(18)12-6-8-13(9-7-12)16(20)17-11-10-15(19)21-4-2/h6-11,14,18H,3-5H2,1-2H3,(H,17,20)/t14-/m1/s1 |
| InChIKey | FHOJGNLJOHUGNL-CQSZACIVSA-N |
| XLogP | 2.33 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|