About N-(1,3-dihydroxypropan-2-yl)-4-[4-[(1R)-1-hydroxybutyl]phenyl]benzamide
N-(1,3-dihydroxypropan-2-yl)-4-[4-[(1R)-1-hydroxybutyl]phenyl]benzamide (PubChem CID 126425192) has the molecular formula C20H25NO4
and a molecular weight of 343.42 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)-4-[4-[(1R)-1-hydroxybutyl]phenyl]benzamide.
Molecular Properties
| Compound Name | N-(1,3-dihydroxypropan-2-yl)-4-[4-[(1R)-1-hydroxybutyl]phenyl]benzamide |
| PubChem CID | 126425192 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-4-[4-[(1R)-1-hydroxybutyl]phenyl]benzamide |
| SMILES | CCC[C@@H](O)c1ccc(-c2ccc(C(=O)NC(CO)CO)cc2)cc1 |
| InChI | InChI=1S/C20H25NO4/c1-2-3-19(24)16-8-4-14(5-9-16)15-6-10-17(11-7-15)20(25)21-18(12-22)13-23/h4-11,18-19,22-24H,2-3,12-13H2,1H3,(H,21,25)/t19-/m1/s1 |
| InChIKey | MKNLDPKNNBRJTB-LJQANCHMSA-N |
| XLogP | 2.27 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1,3-dihydroxypropan-2-yl)-4-[4-[(1R)-1-hydroxybutyl]phenyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-dihydroxypropan-2-yl)-4-[4-[(1R)-1-hydroxybutyl]phenyl]benzamide?
The IUPAC name of N-(1,3-dihydroxypropan-2-yl)-4-[4-[(1R)-1-hydroxybutyl]phenyl]benzamide (CID 126425192) is N-(1,3-dihydroxypropan-2-yl)-4-[4-[(1R)-1-hydroxybutyl]phenyl]benzamide.
What is the SMILES notation for N-(1,3-dihydroxypropan-2-yl)-4-[4-[(1R)-1-hydroxybutyl]phenyl]benzamide?
The canonical SMILES for N-(1,3-dihydroxypropan-2-yl)-4-[4-[(1R)-1-hydroxybutyl]phenyl]benzamide is CCC[C@@H](O)c1ccc(-c2ccc(C(=O)NC(CO)CO)cc2)cc1.
What is the InChIKey of N-(1,3-dihydroxypropan-2-yl)-4-[4-[(1R)-1-hydroxybutyl]phenyl]benzamide?
The InChIKey is MKNLDPKNNBRJTB-LJQANCHMSA-N. The full InChI is InChI=1S/C20H25NO4/c1-2-3-19(24)16-8-4-14(5-9-16)15-6-10-17(11-7-15)20(25)21-18(12-22)13-23/h4-11,18-19,22-24H,2-3,12-13H2,1H3,(H,21,25)/t19-/m1/s1.
What are the key properties of N-(1,3-dihydroxypropan-2-yl)-4-[4-[(1R)-1-hydroxybutyl]phenyl]benzamide?
N-(1,3-dihydroxypropan-2-yl)-4-[4-[(1R)-1-hydroxybutyl]phenyl]benzamide has a molecular weight of 343.42 g/mol, XLogP of 2.27, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-dihydroxypropan-2-yl)-4-[4-[(1R)-1-hydroxybutyl]phenyl]benzamide is sourced from PubChem (CID 126425192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).