C35H28N2O5S — CID 86703272
benzyl 6-[[1-(benzenesulfonyl)-6-methoxy-2-phenylindol-3-yl]methyl]pyridine-2-carboxylate (PubChem CID 86703272) has the molecular formula C35H28N2O5S and a molecular weight of 588.69 g/mol. Its IUPAC name is benzyl 6-[[1-(benzenesulfonyl)-6-methoxy-2-phenylindol-3-yl]methyl]pyridine-2-carboxylate.
| Compound Name | benzyl 6-[[1-(benzenesulfonyl)-6-methoxy-2-phenylindol-3-yl]methyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 86703272 |
| Molecular Formula | C35H28N2O5S |
| Molecular Weight | 588.69 g/mol |
| Exact Mass | 588.17 |
| IUPAC Name | benzyl 6-[[1-(benzenesulfonyl)-6-methoxy-2-phenylindol-3-yl]methyl]pyridine-2-carboxylate |
| SMILES | COc1ccc2c(Cc3cccc(C(=O)OCc4ccccc4)n3)c(-c3ccccc3)n(S(=O)(=O)c3ccccc3)c2c1 |
| InChI | InChI=1S/C35H28N2O5S/c1-41-28-20-21-30-31(22-27-16-11-19-32(36-27)35(38)42-24-25-12-5-2-6-13-25)34(26-14-7-3-8-15-26)37(33(30)23-28)43(39,40)29-17-9-4-10-18-29/h2-21,23H,22,24H2,1H3 |
| InChIKey | CYBWBETXJBMNHL-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.69 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |