C20H34O — CID 86705012
8-[(1R,2S)-2-[[(1R,2R)-2-pentylcyclopropyl]methyl]cyclopropyl]oct-6-yn-1-ol (PubChem CID 86705012) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is 8-[(1R,2S)-2-[[(1R,2R)-2-pentylcyclopropyl]methyl]cyclopropyl]oct-6-yn-1-ol.
| Compound Name | 8-[(1R,2S)-2-[[(1R,2R)-2-pentylcyclopropyl]methyl]cyclopropyl]oct-6-yn-1-ol |
|---|---|
| PubChem CID | 86705012 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | 8-[(1R,2S)-2-[[(1R,2R)-2-pentylcyclopropyl]methyl]cyclopropyl]oct-6-yn-1-ol |
| SMILES | CCCCC[C@@H]1C[C@@H]1C[C@@H]1C[C@@H]1CC#CCCCCCO |
| InChI | InChI=1S/C20H34O/c1-2-3-8-11-17-14-19(17)16-20-15-18(20)12-9-6-4-5-7-10-13-21/h17-21H,2-5,7-8,10-16H2,1H3/t17-,18+,19-,20+/m1/s1 |
| InChIKey | QECNEZDITCTILW-WCIQWLHISA-N |
| XLogP | 5.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|