C19H23F3N4O2 — CID 86708901
(3aR,5R,6aR)-5-amino-3a-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide (PubChem CID 86708901) has the molecular formula C19H23F3N4O2 and a molecular weight of 396.41 g/mol. Its IUPAC name is (3aR,5R,6aR)-5-amino-3a-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide.
| Compound Name | (3aR,5R,6aR)-5-amino-3a-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 86708901 |
| Molecular Formula | C19H23F3N4O2 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (3aR,5R,6aR)-5-amino-3a-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide |
| SMILES | NC(=O)N1C[C@@H]2C[C@@H](N)C[C@]2(C(=O)N2CCc3ccc(C(F)(F)F)cc3C2)C1 |
| InChI | InChI=1S/C19H23F3N4O2/c20-19(21,22)13-2-1-11-3-4-25(8-12(11)5-13)16(27)18-7-15(23)6-14(18)9-26(10-18)17(24)28/h1-2,5,14-15H,3-4,6-10,23H2,(H2,24,28)/t14-,15+,18-/m0/s1 |
| InChIKey | PJOBIMFIPFRJJF-DAYGRLMNSA-N |
| XLogP | 1.71 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |