C24H29F3N4O3 — CID 131732813
tert-butyl N-[(3aR,5R,6aR)-2-cyano-3a-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]carbamate (PubChem CID 131732813) has the molecular formula C24H29F3N4O3 and a molecular weight of 478.52 g/mol. Its IUPAC name is tert-butyl N-[(3aR,5R,6aR)-2-cyano-3a-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]carbamate.
| Compound Name | tert-butyl N-[(3aR,5R,6aR)-2-cyano-3a-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]carbamate |
|---|---|
| PubChem CID | 131732813 |
| Molecular Formula | C24H29F3N4O3 |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | tert-butyl N-[(3aR,5R,6aR)-2-cyano-3a-[7-(trifluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H]2CN(C#N)C[C@@]2(C(=O)N2CCc3ccc(C(F)(F)F)cc3C2)C1 |
| InChI | InChI=1S/C24H29F3N4O3/c1-22(2,3)34-21(33)29-19-9-18-12-30(14-28)13-23(18,10-19)20(32)31-7-6-15-4-5-17(24(25,26)27)8-16(15)11-31/h4-5,8,18-19H,6-7,9-13H2,1-3H3,(H,29,33)/t18-,19+,23-/m0/s1 |
| InChIKey | SYNMNSRTJFMZPB-YYDVJCTNSA-N |
| XLogP | 3.68 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|