C20H25ClFN3O4 — CID 86709080
tert-butyl N-[3-[[4-(4-chloropyrazol-1-yl)-2-fluorophenoxy]methyl]oxan-4-yl]carbamate (PubChem CID 86709080) has the molecular formula C20H25ClFN3O4 and a molecular weight of 425.89 g/mol. Its IUPAC name is tert-butyl N-[3-[[4-(4-chloropyrazol-1-yl)-2-fluorophenoxy]methyl]oxan-4-yl]carbamate.
| Compound Name | tert-butyl N-[3-[[4-(4-chloropyrazol-1-yl)-2-fluorophenoxy]methyl]oxan-4-yl]carbamate |
|---|---|
| PubChem CID | 86709080 |
| Molecular Formula | C20H25ClFN3O4 |
| Molecular Weight | 425.89 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | tert-butyl N-[3-[[4-(4-chloropyrazol-1-yl)-2-fluorophenoxy]methyl]oxan-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCOCC1COc1ccc(-n2cc(Cl)cn2)cc1F |
| InChI | InChI=1S/C20H25ClFN3O4/c1-20(2,3)29-19(26)24-17-6-7-27-11-13(17)12-28-18-5-4-15(8-16(18)22)25-10-14(21)9-23-25/h4-5,8-10,13,17H,6-7,11-12H2,1-3H3,(H,24,26) |
| InChIKey | QWRPCKZXRNYQDQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.89 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |