C12H24O3Si — CID 86709657
(2R)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]but-3-enoic acid (PubChem CID 86709657) has the molecular formula C12H24O3Si and a molecular weight of 244.41 g/mol. Its IUPAC name is (2R)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]but-3-enoic acid.
| Compound Name | (2R)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]but-3-enoic acid |
|---|---|
| PubChem CID | 86709657 |
| Molecular Formula | C12H24O3Si |
| Molecular Weight | 244.41 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (2R)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]but-3-enoic acid |
| SMILES | C=C[C@@H](C(=O)O)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H24O3Si/c1-8-10(11(13)14)9(2)15-16(6,7)12(3,4)5/h8-10H,1H2,2-7H3,(H,13,14)/t9-,10-/m1/s1 |
| InChIKey | UFGLCJJSLNFHGF-NXEZZACHSA-N |
| XLogP | 3.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|