C10H20O3Si — CID 10822622
(2S,3R)-3-hydroxy-2-[(1R)-1-trimethylsilylethyl]pent-4-enoic acid (PubChem CID 10822622) has the molecular formula C10H20O3Si and a molecular weight of 216.35 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-[(1R)-1-trimethylsilylethyl]pent-4-enoic acid.
| Compound Name | (2S,3R)-3-hydroxy-2-[(1R)-1-trimethylsilylethyl]pent-4-enoic acid |
|---|---|
| PubChem CID | 10822622 |
| Molecular Formula | C10H20O3Si |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-[(1R)-1-trimethylsilylethyl]pent-4-enoic acid |
| SMILES | C=C[C@@H](O)[C@@H](C(=O)O)[C@@H](C)[Si](C)(C)C |
| InChI | InChI=1S/C10H20O3Si/c1-6-8(11)9(10(12)13)7(2)14(3,4)5/h6-9,11H,1H2,2-5H3,(H,12,13)/t7-,8-,9+/m1/s1 |
| InChIKey | CQNFJALPHZUHFL-HLTSFMKQSA-N |
| XLogP | 1.96 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|