C11H22O3Si — CID 10513667
(E,2S,3R)-3-hydroxy-2-[(1R)-1-trimethylsilylethyl]hex-4-enoic acid (PubChem CID 10513667) has the molecular formula C11H22O3Si and a molecular weight of 230.38 g/mol. Its IUPAC name is (E,2S,3R)-3-hydroxy-2-[(1R)-1-trimethylsilylethyl]hex-4-enoic acid.
| Compound Name | (E,2S,3R)-3-hydroxy-2-[(1R)-1-trimethylsilylethyl]hex-4-enoic acid |
|---|---|
| PubChem CID | 10513667 |
| Molecular Formula | C11H22O3Si |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (E,2S,3R)-3-hydroxy-2-[(1R)-1-trimethylsilylethyl]hex-4-enoic acid |
| SMILES | C/C=C/[C@@H](O)[C@@H](C(=O)O)[C@@H](C)[Si](C)(C)C |
| InChI | InChI=1S/C11H22O3Si/c1-6-7-9(12)10(11(13)14)8(2)15(3,4)5/h6-10,12H,1-5H3,(H,13,14)/b7-6+/t8-,9-,10+/m1/s1 |
| InChIKey | XJUKQHQMGHWYDV-LQDSRNKPSA-N |
| XLogP | 2.35 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|