C11H20O3 — CID 134888463
(E,2R,3S)-3-hydroxy-2-propyloct-4-enoic acid (PubChem CID 134888463) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is (E,2R,3S)-3-hydroxy-2-propyloct-4-enoic acid.
| Compound Name | (E,2R,3S)-3-hydroxy-2-propyloct-4-enoic acid |
|---|---|
| PubChem CID | 134888463 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (E,2R,3S)-3-hydroxy-2-propyloct-4-enoic acid |
| SMILES | CCC/C=C/[C@H](O)C(CCC)C(=O)O |
| InChI | InChI=1S/C11H20O3/c1-3-5-6-8-10(12)9(7-4-2)11(13)14/h6,8-10,12H,3-5,7H2,1-2H3,(H,13,14)/b8-6+/t9?,10-/m0/s1 |
| InChIKey | ZDPXHWHOQHMSEC-XTDVFMGRSA-N |
| XLogP | 2.20 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|