C15H30O3Si — CID 14035593
(E,2S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylhept-4-enoic acid (PubChem CID 14035593) has the molecular formula C15H30O3Si and a molecular weight of 286.49 g/mol. Its IUPAC name is (E,2S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylhept-4-enoic acid.
| Compound Name | (E,2S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylhept-4-enoic acid |
|---|---|
| PubChem CID | 14035593 |
| Molecular Formula | C15H30O3Si |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | (E,2S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylhept-4-enoic acid |
| SMILES | C[C@H](/C=C/C[C@H](C)C(=O)O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30O3Si/c1-12(9-8-10-13(2)14(16)17)11-18-19(6,7)15(3,4)5/h8-9,12-13H,10-11H2,1-7H3,(H,16,17)/b9-8+/t12-,13+/m1/s1 |
| InChIKey | DKTTVRSPLKMCQB-VSONXHSHSA-N |
| XLogP | 4.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|