C19H34O3Si — CID 134946257
(4E,7Z)-3-[(Z)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]deca-4,7-dienoic acid (PubChem CID 134946257) has the molecular formula C19H34O3Si and a molecular weight of 338.56 g/mol. Its IUPAC name is (4E,7Z)-3-[(Z)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]deca-4,7-dienoic acid.
| Compound Name | (4E,7Z)-3-[(Z)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]deca-4,7-dienoic acid |
|---|---|
| PubChem CID | 134946257 |
| Molecular Formula | C19H34O3Si |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | (4E,7Z)-3-[(Z)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]deca-4,7-dienoic acid |
| SMILES | CC/C=C\C/C=C/C(/C=C\CO[Si](C)(C)C(C)(C)C)CC(=O)O |
| InChI | InChI=1S/C19H34O3Si/c1-7-8-9-10-11-13-17(16-18(20)21)14-12-15-22-23(5,6)19(2,3)4/h8-9,11-14,17H,7,10,15-16H2,1-6H3,(H,20,21)/b9-8-,13-11+,14-12- |
| InChIKey | LRJMZRZAPIIDOO-FAJTYDSQSA-N |
| XLogP | 5.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|