C19H17Cl2N5O3 — CID 86710197
chloromethyl-[3-(2-chloro-4-morpholin-4-ylpyrido[3,2-d]pyrimidin-7-yl)phenyl]carbamic acid (PubChem CID 86710197) has the molecular formula C19H17Cl2N5O3 and a molecular weight of 434.28 g/mol. Its IUPAC name is chloromethyl-[3-(2-chloro-4-morpholin-4-ylpyrido[3,2-d]pyrimidin-7-yl)phenyl]carbamic acid.
| Compound Name | chloromethyl-[3-(2-chloro-4-morpholin-4-ylpyrido[3,2-d]pyrimidin-7-yl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 86710197 |
| Molecular Formula | C19H17Cl2N5O3 |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | chloromethyl-[3-(2-chloro-4-morpholin-4-ylpyrido[3,2-d]pyrimidin-7-yl)phenyl]carbamic acid |
| SMILES | O=C(O)N(CCl)c1cccc(-c2cnc3c(N4CCOCC4)nc(Cl)nc3c2)c1 |
| InChI | InChI=1S/C19H17Cl2N5O3/c20-11-26(19(27)28)14-3-1-2-12(8-14)13-9-15-16(22-10-13)17(24-18(21)23-15)25-4-6-29-7-5-25/h1-3,8-10H,4-7,11H2,(H,27,28) |
| InChIKey | SBUDDBBMBPXPGH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|