C12H12BrClN4O — CID 90038229
4-[7-(bromomethyl)-2-chloropyrido[3,2-d]pyrimidin-4-yl]morpholine (PubChem CID 90038229) has the molecular formula C12H12BrClN4O and a molecular weight of 343.61 g/mol. Its IUPAC name is 4-[7-(bromomethyl)-2-chloropyrido[3,2-d]pyrimidin-4-yl]morpholine.
| Compound Name | 4-[7-(bromomethyl)-2-chloropyrido[3,2-d]pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 90038229 |
| Molecular Formula | C12H12BrClN4O |
| Molecular Weight | 343.61 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | 4-[7-(bromomethyl)-2-chloropyrido[3,2-d]pyrimidin-4-yl]morpholine |
| SMILES | Clc1nc(N2CCOCC2)c2ncc(CBr)cc2n1 |
| InChI | InChI=1S/C12H12BrClN4O/c13-6-8-5-9-10(15-7-8)11(17-12(14)16-9)18-1-3-19-4-2-18/h5,7H,1-4,6H2 |
| InChIKey | PGZHAYIQRHNMPA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.61 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|