C17H18N4O — CID 86711007
3-(4-methyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)-1H-indazol-5-amine (PubChem CID 86711007) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is 3-(4-methyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)-1H-indazol-5-amine.
| Compound Name | 3-(4-methyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)-1H-indazol-5-amine |
|---|---|
| PubChem CID | 86711007 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 3-(4-methyl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)-1H-indazol-5-amine |
| SMILES | CN1CCOc2ccc(-c3n[nH]c4ccc(N)cc34)cc2C1 |
| InChI | InChI=1S/C17H18N4O/c1-21-6-7-22-16-5-2-11(8-12(16)10-21)17-14-9-13(18)3-4-15(14)19-20-17/h2-5,8-9H,6-7,10,18H2,1H3,(H,19,20) |
| InChIKey | PLFXHUUPDNSVMQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|